CymitQuimica logo

CAS 749234-11-5

:

4,5,6,7-tetrabromo-N,N-dimethyl-1H-benzimidazol-2-amine

Description:
4,5,6,7-Tetrabromo-N,N-dimethyl-1H-benzimidazol-2-amine is a synthetic organic compound characterized by its complex structure, which includes a benzimidazole core substituted with four bromine atoms and two dimethylamino groups. This compound typically exhibits high stability due to the presence of multiple bromine atoms, which can enhance its reactivity in certain chemical reactions. The bromine substituents may impart significant hydrophobic characteristics, influencing its solubility in various solvents. Additionally, the dimethylamino groups can contribute to the compound's basicity and potential interactions with biological systems. The presence of the benzimidazole moiety suggests potential applications in pharmaceuticals, particularly as a scaffold for drug development, given its biological activity in various contexts. However, the toxicity and environmental impact of brominated compounds should be considered, as they can pose risks to health and ecosystems. Overall, this compound's unique structural features make it a subject of interest in both synthetic chemistry and medicinal research.
Formula:C9H7Br4N3
InChI:InChI=1/C9H7Br4N3/c1-16(2)9-14-7-5(12)3(10)4(11)6(13)8(7)15-9/h1-2H3,(H,14,15)
InChI key:SLPJGDQJLTYWCI-UHFFFAOYSA-N
SMILES:CN(C)c1nc2c(c(c(c(c2[nH]1)Br)Br)Br)Br
Synonyms:
  • 1H-Benzimidazol-2-amine, 4,5,6,7-tetrabromo-N,N-dimethyl-
  • 2-dimethylamino-4,5,6,7-tetrabromo-1H-benzimidazole
Found 6 products.