CymitQuimica logo

CAS 7496-46-0

:

8-Bromomethylquinoline

Description:
8-Bromomethylquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a bromomethyl group at the 8-position enhances its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound typically appears as a yellow to brown solid and is sparingly soluble in water but more soluble in organic solvents such as ethanol and dichloromethane. Its molecular formula reflects the presence of bromine, carbon, hydrogen, and nitrogen, contributing to its unique chemical properties. 8-Bromomethylquinoline is often utilized in the synthesis of more complex organic molecules and can serve as a building block in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, due to its structural features, it may exhibit biological activity, although specific biological properties would require further investigation. As with many brominated compounds, safety precautions should be taken when handling it, as bromine can be hazardous.
Formula:C10H8BrN
InChI:InChI=1/C10H8BrN/c11-7-9-4-1-3-8-5-2-6-12-10(8)9/h1-6H,7H2
InChI key:IAAUGSYGHOFWEW-UHFFFAOYSA-N
SMILES:c1cc2cccnc2c(c1)CBr
Synonyms:
  • 8-(Bromomethyl)quinoline
Found 5 products.