CymitQuimica logo

CAS 749849-14-7

:

6-bromoimidazo[1,2-a]pyridine-2-carboxylic acid

Description:
6-Bromoimidazo[1,2-a]pyridine-2-carboxylic acid is a heterocyclic compound characterized by its imidazo and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 6-position enhances its reactivity and potential for substitution reactions. This compound features a carboxylic acid functional group, which imparts acidic properties and allows for hydrogen bonding, influencing its solubility and reactivity in various solvents. It is often utilized in medicinal chemistry and drug development due to its biological activity, particularly in the context of targeting specific enzymes or receptors. The molecular structure allows for diverse interactions with biological systems, making it a candidate for further research in pharmacology. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the bromine substituent and the carboxylic acid group. Overall, 6-bromoimidazo[1,2-a]pyridine-2-carboxylic acid is a significant compound in the field of organic chemistry and medicinal applications.
Formula:C8H5BrN2O2
InChI:InChI=1/C8H5BrN2O2/c9-5-1-2-7-10-6(8(12)13)4-11(7)3-5/h1-4H,(H,12,13)
InChI key:FQBFPVLZLNEQOE-UHFFFAOYSA-N
SMILES:c1cc2nc(cn2cc1Br)C(=O)O
Synonyms:
  • Imidazo[1,2-A]Pyridine-2-Carboxylic Acid, 6-Bromo-
  • T56 An Dnj Cvq He
Found 4 products.