CymitQuimica logo

CAS 7500-40-5

:

1H-Azepine, hexahydro-4-phenyl-, hydrochloride (1:1)

Description:
1H-Azepine, hexahydro-4-phenyl-, hydrochloride (1:1) is a chemical compound characterized by its cyclic structure, specifically a saturated seven-membered ring containing nitrogen. The presence of a phenyl group indicates that it has an aromatic substituent, which can influence its chemical reactivity and physical properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The compound may exhibit biological activity, potentially acting as a ligand or interacting with specific receptors due to its structural features. Its CAS number, 7500-40-5, allows for easy identification and reference in chemical databases. Safety data sheets would provide information on handling, storage, and potential hazards associated with this compound, emphasizing the importance of proper laboratory practices when working with it. Overall, 1H-Azepine, hexahydro-4-phenyl-, hydrochloride is of interest in both synthetic chemistry and medicinal chemistry contexts.
Formula:C12H17N·ClH
InChI:InChI=1S/C12H17N.ClH/c1-2-5-11(6-3-1)12-7-4-9-13-10-8-12;/h1-3,5-6,12-13H,4,7-10H2;1H
InChI key:InChIKey=AZUFAMJWMHXXST-UHFFFAOYSA-N
SMILES:C1(=CC=CC=C1)C2CCCNCC2.Cl
Synonyms:
  • 1H-Azepine, hexahydro-4-phenyl-, hydrochloride
  • 1H-Azepine, hexahydro-4-phenyl-, hydrochloride (1:1)
  • 4-Phenylazepane hydrochloride
Found 4 products.