CymitQuimica logo

CAS 75039-60-0

:

5-(dimethylaminomethylene)-2,2-dimethyl-1,3-dioxa

Description:
5-(Dimethylaminomethylene)-2,2-dimethyl-1,3-dioxa, identified by its CAS number 75039-60-0, is an organic compound characterized by its unique structural features, including a dioxane ring and a dimethylamino group. This compound typically exhibits properties associated with both amines and ethers due to the presence of the dimethylamino moiety and the dioxane structure. It is likely to be a colorless to pale yellow liquid or solid, depending on its specific form and purity. The presence of the dimethylamino group suggests potential basicity and nucleophilicity, which may influence its reactivity in various chemical reactions, such as nucleophilic substitutions or condensation reactions. Additionally, the dioxane ring contributes to its stability and solubility in organic solvents. This compound may find applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of other chemical entities. However, specific safety and handling guidelines should be followed due to the potential hazards associated with amine-containing compounds.
Formula:C9H13NO4
InChI:InChI=1/C9H13NO4/c1-9(2)13-7(11)6(5-10(3)4)8(12)14-9/h5H,1-4H3
InChI key:YKMXFLMJEHHKMU-UHFFFAOYSA-N
SMILES:CC1(C)OC(=O)C(=CN(C)C)C(=O)O1
Synonyms:
  • 5-(Dimethylaminomethylene)-2,2-dimethyl-1,3-dioxane-4,6-dione
  • 5-[(Dimethylamino)Methylidene]-2,2-Dimethyl-1,3-Dioxane-4,6-Dione
Found 3 products.