CAS 75059-22-2
:3'-deoxy-3'-fluoroadenosine
Description:
3'-Deoxy-3'-fluoroadenosine is a modified nucleoside that features a fluorine atom at the 3' position of the ribose sugar moiety, replacing the hydroxyl group typically found in adenosine. This modification imparts unique biochemical properties, making it a valuable compound in biochemical research and potential therapeutic applications. The presence of the fluorine atom can enhance the stability of the nucleoside against enzymatic degradation, which is advantageous for drug development. Additionally, 3'-deoxy-3'-fluoroadenosine can influence the binding affinity and specificity of nucleic acid interactions, potentially impacting processes such as RNA transcription and translation. Its structural characteristics allow it to serve as a useful tool in studying nucleic acid metabolism and in the design of antiviral or anticancer agents. The compound is typically handled with standard laboratory safety protocols, as with other nucleoside analogs, due to its potential biological activity.
Formula:C10H12FN5O3
InChI:InChI=1/C10H12FN5O3/c11-5-4(1-17)19-10(7(5)18)16-3-15-6-8(12)13-2-14-9(6)16/h2-5,7,10,17-18H,1H2,(H2,12,13,14)/t4-,5-,7-,10-/m1/s1
SMILES:C([C@@H]1[C@H]([C@H]([C@H](n2cnc3c(N)ncnc23)O1)O)F)O
Synonyms:- Adenosine, 3'-Deoxy-3'-Fluoro-
- 3'-fluoro-3'-deoxyadenosine
- 3'-F-3'-rA
- (2R,3S,4S,5R)-2-(6-Amino-9H-purin-9-yl)-4-fluoro-5-(hydroxymethyl)tetrahydrofuran-3-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(2R,3S,4S,5R)-2-(6-Amino-9H-purin-9-yl)-4-fluoro-5-(hydroxymethyl)tetrahydrofuran-3-ol
CAS:Formula:C10H12FN5O3Purity:98%Color and Shape:SolidMolecular weight:269.23243'-Deoxy-3'-fluoroadenosine
CAS:3'-Deoxy-3'-fluoroadenosineFormula:C10H12FN5O3Purity:≥98%Molecular weight:269.233'-Deoxy-3'-fluoroadenosine
CAS:3'-Deoxy-3'-fluoroadenosine is a purine nucleoside analogue with a wide range of anti-tumor and anti-viral activity, and has inhibitory effects on tick-borneFormula:C10H12FN5O3Purity:99.84%Color and Shape:SolidMolecular weight:269.233'-Deoxy-3'-fluoroadenosine
CAS:3'-Deoxy-3'-fluoroadenosine is a potent inhibitor of the phosphodiesterase enzyme, which is an important component of many different cellular processes. It has been shown to inhibit the activity of phosphodiesterase in cell culture and in serum alanine. 3'-Deoxy-3'-fluoroadenosine also inhibits the synthesis of uridine triphosphate, which is required for DNA replication and protein synthesis. The acid complex form has potent inhibition properties against viruses such as alphaviruses, and it also inhibits transport of nucleic acids into cells. 3'-Deoxy-3'-fluoroadenosine can act as an analog to adenosine and may be used to treat viral infections such as HIV or herpes simplex virus.Formula:C10H12FN5O3Purity:Min. 95%Color and Shape:White PowderMolecular weight:269.23 g/mol





