CymitQuimica logo

CAS 7507-93-9

:

3-Nitro-6,7,8,9-tetrahydro-5H-benzo[a]cyclohepten-5-one

Description:
3-Nitro-6,7,8,9-tetrahydro-5H-benzo[a]cyclohepten-5-one is an organic compound characterized by its complex bicyclic structure, which includes a nitro group and a ketone functional group. The presence of the nitro group typically imparts polar characteristics, influencing the compound's reactivity and solubility in various solvents. The tetrahydro structure indicates that the compound is saturated, contributing to its stability and potentially affecting its biological activity. This compound may exhibit interesting properties due to its unique arrangement of carbon atoms and functional groups, making it a subject of interest in synthetic organic chemistry and medicinal chemistry. Its CAS number, 7507-93-9, allows for easy identification in chemical databases. The compound's potential applications could range from use in pharmaceuticals to serving as an intermediate in organic synthesis, although specific applications would depend on further research into its biological activity and chemical behavior. Overall, 3-Nitro-6,7,8,9-tetrahydro-5H-benzo[a]cyclohepten-5-one represents a fascinating example of complex organic chemistry.
Formula:C11H11NO3
InChI:InChI=1S/C11H11NO3/c13-11-4-2-1-3-8-5-6-9(12(14)15)7-10(8)11/h5-7H,1-4H2
InChI key:InChIKey=VDNGDQXLGGSHHT-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC=C(N(=O)=O)C2)CCCC1
Synonyms:
  • 6,7,8,9-Tetrahydro-3-nitro-5H-benzocyclohepten-5-one
  • NSC 401448
  • 5H-Benzocyclohepten-5-one, 6,7,8,9-tetrahydro-3-nitro-
  • 3-Nitrobenzosuberone
  • 3-Nitro-6,7,8,9-tetrahydro-5H-benzocyclohepten-5-one
Found 2 products.