CAS 75148-49-1
:3-bromobenzaldehyde diethyl acetal
Description:
3-Bromobenzaldehyde diethyl acetal is an organic compound characterized by its structure, which includes a benzaldehyde moiety substituted with a bromine atom at the meta position and two ethyl groups attached to the carbonyl carbon as acetal groups. This compound typically appears as a colorless to pale yellow liquid with a distinctive aromatic odor. It is soluble in organic solvents such as ethanol and diethyl ether but has limited solubility in water due to its hydrophobic ethyl groups. The presence of the bromine atom introduces electrophilic characteristics, making it a useful intermediate in organic synthesis, particularly in the formation of various derivatives through nucleophilic substitution reactions. Additionally, the acetal functional group provides stability to the aldehyde, protecting it from oxidation. 3-Bromobenzaldehyde diethyl acetal is utilized in various applications, including in the synthesis of pharmaceuticals and agrochemicals, as well as in research settings for studying reaction mechanisms involving acetal formation and cleavage. Proper handling and storage are essential due to its potential reactivity and the presence of bromine, which can pose health hazards.
Formula:C11H15BrO2
InChI:InChI=1/C11H15BrO2/c1-3-13-11(14-4-2)9-6-5-7-10(12)8-9/h5-8,11H,3-4H2,1-2H3
SMILES:CCOC(c1cccc(c1)Br)OCC
Synonyms:- 3-Bromo-alpha,alpha-diethoxytoluene
- 1-Bromo-3-(Diethoxymethyl)Benzene
- 3-Bromobenzaldehyde Diethylacetal
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Bromobenzaldehyde Diethyl Acetal
CAS:Formula:C11H15BrO2Purity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:259.141-Bromo-3-(diethoxymethyl)benzene
CAS:Formula:C11H15BrO2Purity:97%Color and Shape:SolidMolecular weight:259.13961-Bromo-3-(diethoxymethyl)benzene
CAS:1-Bromo-3-(diethoxymethyl)benzeneFormula:C11H15BrO2Purity:>98%Molecular weight:259.143-Bromobenzaldehyde Diethyl Acetal
CAS:3-Bromobenzaldehyde Diethyl AcetalFormula:C11H15BrO2Purity:97%Molecular weight:259.14




