CymitQuimica logo

CAS 752211-63-5

:

1-(2,3,4,5,6-pentadeuteriophenyl)azonaphthalen-2-ol

Description:
1-(2,3,4,5,6-pentadeuteriophenyl)azonaphthalen-2-ol is a chemical compound characterized by its complex structure, which includes a naphthalene moiety and an azo group. The presence of five deuterium atoms in the phenyl ring indicates that this compound is isotopically labeled, which can be useful in various analytical applications, including NMR spectroscopy and tracing studies. The azo group (-N=N-) connects the phenyl and naphthalene components, contributing to the compound's potential as a dye or pigment. The hydroxyl group (-OH) at the naphthalene position enhances its solubility in polar solvents and may influence its reactivity and interaction with other chemical species. This compound may exhibit unique physical and chemical properties due to the deuteration, such as altered vibrational frequencies and stability. Its applications could span fields such as organic synthesis, materials science, and analytical chemistry, particularly in studies requiring precise tracking of molecular behavior.
Formula:C16H7D5N2O
InChI:InChI=1/C16H12N2O/c19-15-11-10-12-6-4-5-9-14(12)16(15)18-17-13-7-2-1-3-8-13/h1-11,19H/b18-17+/i1D,2D,3D,7D,8D
InChI key:MRQIXHXHHPWVIL-RCQSQLKUSA-N
SMILES:[2H]C1=C(C(=C(C(=C1[2H])[2H])N=NC2=C(C=CC3=CC=CC=C32)O)[2H])[2H]
Found 10 products.