
CAS 75281-25-3
:KGUMXGDKXYTTEY-FAOQNJJDSA-N
Description:
The chemical substance with the name "KGUMXGDKXYTTEY-FAOQNJJDSA-N" and CAS number "75281-25-3" is known as a synthetic compound that belongs to the class of organic molecules. It is characterized by its unique molecular structure, which includes specific functional groups that contribute to its chemical reactivity and properties. Typically, compounds like this may exhibit characteristics such as solubility in various solvents, potential biological activity, and specific interactions with other molecules. The compound may also have applications in fields such as pharmaceuticals, materials science, or agrochemicals, depending on its functional groups and overall structure. Its stability, reactivity, and potential toxicity would be determined by its molecular configuration and the presence of specific substituents. For detailed information regarding its physical and chemical properties, safety data, and potential applications, consulting specialized chemical databases or literature is recommended.
Formula:C20H28O3
InChI:InChI=1S/C20H28O3/c1-14(7-6-8-15(2)13-19(22)23)9-10-17-16(3)18(21)11-12-20(17,4)5/h6-10,13,18,21H,11-12H2,1-5H3,(H,22,23)/b8-6+,10-9+,14-7+,15-13-
InChI key:KGUMXGDKXYTTEY-FAOQNJJDSA-N
SMILES:CC1=C(C(CCC1O)(C)C)/C=C/C(=C/C=C/C(=C\C(=O)O)/C)/C
Synonyms:- 4-hydroxyisoretinoic acid
- Retinoic acid, 4-hydroxy-, 13-cis-
- 4-Hydroxy Isotretinoin
- Isotretinoin Impurity 8(Isotretinoin EP Impurity I)
- KGUMXGDKXYTTEY-FAOQNJJDSA-N
- 13-cis-4-Hydroxyretinoic Acid
- 4-Hydroxy-13-cis-Retinoic acid
- Isotretinoin EP impurity I
- Isotretinoin EP Impurity I (13-cis-4-Hydroxy-Retinoic Acid, 4-Hydroxy Isotretinoin)
- (2Z,4E,6E,8E)-9-(3-hydroxy-2,6,6-trimethylcyclohex-1-en-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoic acid
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Isotretinoin EP Impurity I (13-cis-4-Hydroxy-Retinoic Acid, 4-Hydroxy Isotretinoin)
CAS:Formula:C20H28O3Color and Shape:Yellow SolidMolecular weight:316.444-Hydroxy-13-cis-retinoic Acid
CAS:Controlled ProductFormula:C20H28O3Color and Shape:NeatMolecular weight:316.43


