CAS 75288-96-9
:Kukoamine A
Description:
Kukoamine A is a naturally occurring alkaloid primarily derived from the plant species of the genus *Lycium*, particularly *Lycium chinense*. It is characterized by its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. Kukoamine A has been studied for its potential pharmacological properties, including antioxidant, anti-inflammatory, and neuroprotective effects. The compound exhibits a unique stereochemistry that may influence its interaction with biological targets. Additionally, Kukoamine A is known for its low toxicity profile, making it a subject of interest in medicinal chemistry and natural product research. Its solubility properties can vary depending on the solvent used, which is important for its application in various formulations. Overall, Kukoamine A represents a promising candidate for further investigation in the development of therapeutic agents, particularly in the context of neurodegenerative diseases and other health conditions.
Formula:C28H42N4O6
InChI:InChI=1S/C28H42N4O6/c33-23-9-5-21(19-25(23)35)7-11-27(37)31-17-3-15-29-13-1-2-14-30-16-4-18-32-28(38)12-8-22-6-10-24(34)26(36)20-22/h5-6,9-10,19-20,29-30,33-36H,1-4,7-8,11-18H2,(H,31,37)(H,32,38)
InChI key:InChIKey=IOLDDENZPBFBHV-UHFFFAOYSA-N
SMILES:C(CC(NCCCNCCCCNCCCNC(CCC1=CC(O)=C(O)C=C1)=O)=O)C2=CC(O)=C(O)C=C2
Synonyms:- Kukoamine A
- N,N′-[1,4-Butanediylbis(imino-3,1-propanediyl)]bis[3,4-dihydroxybenzenepropanamide]
- N<sup>1</sup>,N<sup>12</sup>-Bis(dihydrocaffeoyl) spermine
- N<sup>1</sup>,N<sup>14</sup>-Bis(dihydrocaffeoyl)spermine
- Zinc 13513540
- N1,N12-Bis(dihydrocaffeoyl) spermine
- Benzenepropanamide, N,N′-[1,4-butanediylbis(imino-3,1-propanediyl)]bis[3,4-dihydroxy-
- N1,N14-Bis(dihydrocaffeoyl)spermine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Kukoamine A-d8 DiHCl
CAS:Formula:C28H34D8N4O6·2HClColor and Shape:White To Off-White SolidMolecular weight:538.71 2*36.46Kukoamine A DiHCl
CAS:Formula:C28H42N4O6·2HClColor and Shape:White To Off-White SolidMolecular weight:530.67 2*36.46Kukoamine A
CAS:Kukoamine A possesses anticancer, cytoprotective, antioxidant, and anti-inflammatory activities, it also has neuroprotective effects through inhibiting oxidative stress and apoptosis after whole-brain irradiation (WBI) in rats. Kukoamine A prevents radiation-induced neuroinflammation and preserves hippocampal neurogenesis in rats by inhibiting activation of NF-κB and AP-1. It attenuates insulin resistance and fatty liver through downregulation of Srebp-1c.Formula:C28H42N4O6Purity:95%~99%Molecular weight:530.666Kukoamine A
CAS:Kukoamine A: anticancer, cytoprotective, antioxidant, anti-inflammatory, inhibits trypanothione reductase (mixed inhibitor, Ki=1.8µM).Formula:C28H42N4O6Purity:99.28% - 99.35%Color and Shape:SolidMolecular weight:530.66Kukoamine A
CAS:Cyclic amideFormula:C28H42N4O6Purity:≥ 90.0 % (HPLC)Color and Shape:Solid - viscousMolecular weight:530.66Kukoamine A
CAS:Kukoamine A is a bioactive polyamine alkaloid, which is primarily derived from the root bark of the Lycium chinense plant, commonly known as goji or Chinese boxthorn. It features prominently in traditional medicine due to its potential therapeutic properties. Kukoamine A is known to exhibit multiple biological activities by interacting with various molecular targets within the body. Its primary mode of action involves antioxidant, antihypertensive, and anti-inflammatory properties, which are achieved through modulation of oxidative stress pathways and inhibition of inflammatory mediators.
Formula:C28H42N4O6Purity:Min. 95%Molecular weight:530.66 g/mol






