CymitQuimica logo

CAS 753501-37-0

:

Benzenamine,4-ethynyl-2,6-difluoro-

Description:
Benzenamine, 4-ethynyl-2,6-difluoro- is an organic compound characterized by its aromatic amine structure, which includes a benzene ring substituted with an ethynyl group and two fluorine atoms at the 2 and 6 positions. The presence of the ethynyl group introduces a triple bond, contributing to the compound's reactivity and potential applications in organic synthesis and materials science. The difluoro substituents enhance the compound's electronic properties, potentially influencing its behavior in chemical reactions and interactions with other molecules. This compound may exhibit unique physical properties, such as solubility and boiling point, influenced by the fluorine atoms and the ethynyl group. Additionally, due to the presence of the amine functional group, it may participate in hydrogen bonding, affecting its reactivity and interactions in various chemical environments. Overall, Benzenamine, 4-ethynyl-2,6-difluoro- is of interest in fields such as medicinal chemistry and materials development due to its distinctive structural features and potential applications.
Formula:C8H5F2N
InChI:InChI=1S/C8H5F2N/c1-2-5-3-6(9)8(11)7(10)4-5/h1,3-4H,11H2
InChI key:QGXKGXSOQYMBCK-UHFFFAOYSA-N
SMILES:C#CC1=CC(=C(C(=C1)F)N)F
Synonyms:
  • 4-Ethynyl-2,6-Difluoro-Phenylamine
  • Benzenamine, 4-ethynyl-2,6-difluoro- (9CI)
Found 4 products.