CymitQuimica logo

CAS 75370-65-9

:

2H-Benzimidazol-2-one,4-amino-1,3-dihydro-

Description:
2H-Benzimidazol-2-one, 4-amino-1,3-dihydro- is a chemical compound characterized by its bicyclic structure, which includes a benzimidazole ring fused with a carbonyl group and an amino substituent. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the amino group. The presence of the amino group also suggests that it may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. This compound may be of interest in medicinal chemistry due to its structural features, which can be associated with biological activity. Additionally, it may serve as a precursor or intermediate in the synthesis of more complex organic molecules. Its CAS number, 75370-65-9, allows for easy identification in chemical databases and literature. Overall, 2H-Benzimidazol-2-one, 4-amino-1,3-dihydro- represents a class of compounds that can be explored for various applications in pharmaceuticals and materials science.
Formula:C7H7N3O
InChI:InChI=1S/C7H7N3O/c8-4-2-1-3-5-6(4)10-7(11)9-5/h1-3H,8H2,(H2,9,10,11)
InChI key:BCUSTVNWMJXDSE-UHFFFAOYSA-N
SMILES:C1=CC(=C2C(=C1)NC(=O)N2)N
Synonyms:
  • 2-Benzimidazolinone,4-amino- (6CI)
  • 4-Amino-2-benzimidazolone
Found 5 products.