CymitQuimica logo

CAS 75400-67-8

:

1-Boc-indole

Description:
1-Boc-indole, with the CAS number 75400-67-8, is a derivative of indole, a bicyclic compound known for its aromatic properties and presence in various natural products. The "Boc" in its name refers to the tert-butyloxycarbonyl (Boc) protecting group, which is commonly used in organic synthesis to protect amines during chemical reactions. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as dichloromethane and dimethyl sulfoxide, but less soluble in water. 1-Boc-indole is often utilized in the synthesis of pharmaceuticals and biologically active compounds due to its ability to undergo various chemical transformations, including nucleophilic substitutions and cyclizations. Its structure allows for the introduction of functional groups, making it a versatile intermediate in organic synthesis. Additionally, the presence of the Boc group enhances the stability of the indole nitrogen, facilitating its use in peptide synthesis and other applications in medicinal chemistry.
Formula:C13H15NO2
InChI:InChI=1/C13H15NO2/c1-13(2,3)16-12(15)14-9-8-10-6-4-5-7-11(10)14/h4-9H,1-3H3
InChI key:OWPIFQXNMLDXKW-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)n1ccc2ccccc12
Synonyms:
  • 1-(tert-Butoxycarbonyl)indole
  • tert-Butyl 1-indolecarboxylate
  • tert-butyl 1H-indole-1-carboxylate
Found 6 products.