CymitQuimica logo

CAS 754131-60-7

:

3-bromo-2-(bromomethyl)pyridine

Description:
3-Bromo-2-(bromomethyl)pyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of bromine substituents at the 2 and 3 positions of the pyridine ring contributes to its reactivity and potential applications in organic synthesis. This compound typically appears as a colorless to light yellow liquid or solid, depending on its physical state at room temperature. It is soluble in organic solvents, which enhances its utility in various chemical reactions. The bromomethyl group at the 2-position makes it a versatile intermediate for further functionalization, allowing for the introduction of diverse substituents. Due to the presence of halogens, this compound may exhibit significant biological activity, making it of interest in medicinal chemistry and material science. Safety precautions should be observed when handling this compound, as brominated compounds can be hazardous. Overall, 3-bromo-2-(bromomethyl)pyridine serves as an important building block in the synthesis of more complex organic molecules.
Formula:C6H5Br2N
InChI:InChI=1/C6H5Br2N/c7-4-6-5(8)2-1-3-9-6/h1-3H,4H2
InChI key:FVIZOBDAEIFYGH-UHFFFAOYSA-N
SMILES:c1cc(c(CBr)nc1)Br
Synonyms:
  • Pyridine, 3-Bromo-2-(Bromomethyl)-
Found 5 products.