CAS 754214-56-7
:7-Azaindole-5-boronic acid pinacol ester
Description:
7-Azaindole-5-boronic acid pinacol ester is a chemical compound characterized by its unique structure, which includes a boronic acid moiety and an azaindole framework. This compound typically exhibits properties associated with both boronic acids and heterocyclic compounds. The presence of the boronic acid group allows for potential applications in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The pinacol ester form enhances its stability and solubility, facilitating its use in various chemical reactions. Additionally, the azaindole structure contributes to its aromaticity and potential biological activity, as compounds containing azaindoles are often explored for their pharmacological properties. Overall, 7-Azaindole-5-boronic acid pinacol ester is a versatile compound with significant implications in synthetic organic chemistry and drug development, owing to its reactivity and structural features.
Formula:C13H17BN2O2
InChI:InChI=1/C13H19BN2O3/c1-12(2,17)13(3,4)19-14(18)10-7-9-5-6-15-11(9)16-8-10/h5-8,17-18H,1-4H3,(H,15,16)
SMILES:CC(C)(C(C)(C)OB(c1cc2ccnc2[nH]c1)O)O
Synonyms:- 7-(4-methylbenzenesulfonyl)-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-7H-pyrrolo[2,3-d]pyrimidine
- 5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine
- 5-(4,4,5,5-Tetramethyl-[1,3,2]Dioxaborolan-2-Yl)-1H-Pyrrolo[2,3-B]Pyridine
- 5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-pyrrolo2,3-bpyridine
- Pyrrolo[2,3-b]pyridin-5-ylboronic acid pinacol ester
- 3-hydroxy-2,3-dimethylbutan-2-yl hydrogen 1H-pyrrolo[2,3-b]pyridin-5-ylboronate
- 1H-Pyrrolo[2,3-b]pyridine, 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 7-Azaindole-5-boronic acid pinacol ester
- 1H-Pyrrolo[2,3-B]pyridine-5-boronic acid pinacol ester
- 7-Azaindole-5-boronic acid pinacol ester ISO 9001:2015 REACH
- Pyrrolo[2,3-b)pyridine-5-boronic acid,pinacol ester
- 7-Azaindole-5-boronic aci...
- 1H-Pyrrolo[2,3-b]pyridine,5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- (CAS No.754214-56-7)
- 5-(4,4,5,5-TETRAMETHYL-[1,3,2]DIOXABOROLAN-2-YL)-1
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
7-Azaindole-5-boronic acid pinacol ester, 97%
CAS:7-Azaindole-5-boronic acid pinacol ester is used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item codeFormula:C13H17BN2O2Purity:97%Color and Shape:Solid, White to pale yellowMolecular weight:244.107-Azaindole-5-boronic acid, pinacol ester
CAS:7-Azaindole-5-boronic acid, pinacol esterFormula:C13H17BN2O2Purity:97%Color and Shape:SolidMolecular weight:244.09728Pyrrolo[2,3-b]pyridine-5-boronic acid, pinacol ester
CAS:Formula:C13H17BN2O2Purity:95%Color and Shape:LiquidMolecular weight:244.09735-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine
CAS:Formula:C13H17BN2O2Purity:97%Color and Shape:SolidMolecular weight:244.1





