CAS 75423-15-3
:4-methyl-1,2,3-thiadiazole-5-carbohydrazide
Description:
4-Methyl-1,2,3-thiadiazole-5-carbohydrazide is a heterocyclic organic compound characterized by its thiadiazole ring, which contains both sulfur and nitrogen atoms. This compound features a methyl group at the 4-position and a carbohydrazide functional group at the 5-position of the thiadiazole ring. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of hydrazide functionality, which can engage in hydrogen bonding. The compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activities. Its structure allows for various chemical modifications, which can enhance its reactivity and efficacy in applications. Additionally, the presence of the thiadiazole moiety often contributes to unique electronic properties, making it a subject of study in materials science and medicinal chemistry. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.
Formula:C4H6N4OS
InChI:InChI=1/C4H6N4OS/c1-2-3(4(9)6-5)10-8-7-2/h5H2,1H3,(H,6,9)
SMILES:Cc1c(C(=NN)O)snn1
Synonyms:- 1,2,3-Thiadiazole-5-carboxylic acid, 4-methyl-, hydrazide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Methyl-1,2,3-thiadiazole-5-carbohydrazide
CAS:4-Methyl-1,2,3-thiadiazole-5-carbohydrazideFormula:C4H6N4OSPurity:≥95%Color and Shape:White SolidMolecular weight:158.181644-Methyl-1,2,3-thiadiazole-5-carbohydrazide
CAS:Formula:C4H6N4OSPurity:98%Color and Shape:SolidMolecular weight:158.18164-Methyl-1,2,3-thiadiazole-5-carbohydrazide
CAS:Formula:C4H6N4OSPurity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:158.184-Methyl-1,2,3-thiadiazole-5-carbohydrazide
CAS:4-Methyl-1,2,3-thiadiazole-5-carbohydrazide (MTT) is a chemical compound that has been used in the past as an antimicrobial agent. It is made from the acid hydrazide of 4-methylthiadiazole and methyl iodide. The inhibitory concentration of MTT for bacteria is between 0.0004 and 1 mg/L, and its bactericidal concentration ranges from 0.001 to 10 mg/L. MTT has been shown to be effective against a wide range of microorganisms, including Gram-positive and Gram-negative bacteria, yeast, fungi, protozoa and helminths. MTT has also been shown to have no significant cytotoxic effects on mammalian cells when exposed at concentrations less than 500 μg/mL.Formula:C4H6N4OSPurity:Min. 95%Molecular weight:158.18 g/mol



