CAS 75434-18-3
:2-Quinolinecarboxylic acid, 6-hydroxy-
Description:
2-Quinolinecarboxylic acid, 6-hydroxy- is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features a carboxylic acid functional group (-COOH) and a hydroxyl group (-OH) at the 6-position of the quinoline ring, contributing to its acidic and potentially polar properties. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the hydroxyl group. The compound may participate in various chemical reactions, including esterification and substitution reactions, owing to its functional groups. Additionally, it may exhibit biological activity, making it of interest in pharmaceutical research. Its CAS number, 75434-18-3, allows for precise identification in chemical databases. Overall, 2-Quinolinecarboxylic acid, 6-hydroxy- is a compound of interest in both synthetic organic chemistry and medicinal chemistry due to its unique structural features and potential applications.
Formula:C10H7NO3
InChI:InChI=1S/C10H7NO3/c12-7-2-4-8-6(5-7)1-3-9(11-8)10(13)14/h1-5,12H,(H,13,14)
InChI key:KVQARDYXZJGMFU-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=CC(=N2)C(=O)O)C=C1O
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
6-Hydroxy-2-quinolinecarboxylic acid
CAS:Formula:C10H7NO3Purity:97%Color and Shape:SolidMolecular weight:189.16756-Hydroxyquinoline-2-carboxylic acid
CAS:6-Hydroxyquinoline-2-carboxylic acidFormula:C10H7NO3Purity:98%Molecular weight:189.176-Hydroxyquinoline-2-carboxylic acid
CAS:6-Hydroxyquinoline-2-carboxylic acidFormula:C10H7NO3Purity:98%Molecular weight:189.176-HYDROXYQUINOLINE-2-CARBOXYLIC ACID
CAS:Formula:C10H7NO3Purity:98%Color and Shape:SolidMolecular weight:189.176-hydroxyquinoline-2-carboxylic acid
CAS:Controlled ProductApplications 6-hydroxyquinoline-2-carboxylic acid (cas# 75434-18-3) is a useful research chemical.
Formula:C10H7NO3Color and Shape:NeatMolecular weight:189.176-hydroxyquinoline-2-carboxylic acid
CAS:6-Hydroxyquinoline-2-carboxylic acid is a drug that has been shown to inhibit phospholipidosis, which is the accumulation of phospholipids in cells. It also inhibits naphthalene-induced hyperphosphorylation and histamine release from mast cells. 6-Hydroxyquinoline-2-carboxylic acid is an acceptor for the pharmacophore model and has been validated by molecular properties. The optimization process for this compound was monitored and validated. This lead compound is being considered as a potential therapeutic agent for the treatment of autoimmune diseases such as multiple sclerosis, rheumatoid arthritis, and lupus erythematosus.Formula:C10H7NO3Purity:Min. 95%Molecular weight:189.17 g/mol





