CymitQuimica logo

CAS 75438-78-7

:

4,6-Dichloro-2-Cyclopropyl-5-Nitropyrimidine

Description:
4,6-Dichloro-2-Cyclopropyl-5-Nitropyrimidine is a heterocyclic organic compound characterized by its pyrimidine ring structure, which is a six-membered ring containing two nitrogen atoms at the 1 and 3 positions. This compound features two chlorine substituents at the 4 and 6 positions, contributing to its reactivity and potential biological activity. The presence of a cyclopropyl group at the 2 position adds to its structural complexity and may influence its pharmacological properties. Additionally, the nitro group at the 5 position enhances its electron-withdrawing characteristics, which can affect its chemical behavior and interactions. This compound is of interest in medicinal chemistry and may have applications in the development of pharmaceuticals, particularly in the field of antimicrobial or anticancer agents. Its unique combination of functional groups and structural features makes it a subject of study for researchers exploring new therapeutic compounds. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C7H5Cl2N3O2
InChI:InChI=1S/C7H5Cl2N3O2/c8-5-4(12(13)14)6(9)11-7(10-5)3-1-2-3/h3H,1-2H2
InChI key:XCAAKLMJGXTCMA-UHFFFAOYSA-N
SMILES:C1CC1C2=NC(=C(C(=N2)Cl)[N+](=O)[O-])Cl
Synonyms:
  • 4,6-Dichloro-2-Cyclopropyl-5-Nitropyrimidine
Found 3 products.