CymitQuimica logo

CAS 7545-71-3

:

2-isopropyl-6-nitrophenol

Description:
2-Isopropyl-6-nitrophenol is an organic compound characterized by its phenolic structure, which includes a nitro group and an isopropyl substituent. This compound typically appears as a yellow to orange crystalline solid and is known for its moderate solubility in organic solvents, while being less soluble in water due to the presence of the hydrophobic isopropyl group. The nitro group contributes to its reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitution. It is often used in research and industrial applications, particularly in the synthesis of dyes, pharmaceuticals, and agrochemicals. The compound exhibits specific functional properties, such as acidity, due to the hydroxyl group, which can participate in hydrogen bonding. Safety considerations are important when handling this substance, as nitrophenols can be toxic and may pose environmental hazards. Proper storage and disposal methods should be followed to mitigate risks associated with its use.
Formula:C9H11NO3
InChI:InChI=1/C9H11NO3/c1-6(2)7-4-3-5-8(9(7)11)10(12)13/h3-6,11H,1-2H3
InChI key:RRFSVDKJKYCCEK-UHFFFAOYSA-N
SMILES:CC(C)c1cccc(c1O)N(=O)=O
Synonyms:
  • 2-Nitro-6-(Propan-2-Yl)Phenol
Found 2 products.