CAS 75464-52-7: 2,5-Diamino-1,4-benzenedithiol dihydrochloride

Description:2,5-Diamino-1,4-benzenedithiol dihydrochloride is an organic compound characterized by the presence of two amino groups and two thiol groups attached to a benzene ring. This compound is typically encountered as a dihydrochloride salt, which enhances its solubility in water. The presence of amino groups makes it a potential candidate for various applications in organic synthesis, particularly in the formation of complex molecules and as a building block in pharmaceuticals. The thiol groups contribute to its reactivity, allowing it to participate in redox reactions and form disulfide bonds, which are significant in biochemistry and materials science. Additionally, the compound may exhibit properties such as chelation with metal ions, making it useful in coordination chemistry. Safety considerations should be taken into account, as thiols can be malodorous and may pose health risks upon exposure. Overall, 2,5-Diamino-1,4-benzenedithiol dihydrochloride is a versatile compound with potential applications in various fields, including medicinal chemistry and materials development.

Formula:C₆H₁₀Cl₂N₂S₂

InChI:InChI=1/C6H8N2S2.2ClH/c7-3-1-5(9)4(8)2-6(3)10;;/h1-2,9-10H,7-8H2;2*1H

Synonyms:
2,5-Diaminobenzene-1,4-Dithiol Dihydrochloride

Found 5 products.

Product data	Purity	Price range	Estimated delivery
2,5-Diamino-1,4-benzenedithiol Dihydrochloride REF: 3B-D2022CAS: 75464-52-7	>97.0%(HPLC)	366.00 €~1,527.00 €	Tue 29 Apr 25
2,5-Diaminobenzene-1,4-dithiol dihydrochloride REF: IN-DA003FWLCAS: 75464-52-7	97%	To inquire	Tue 06 May 25
2,5-Diaminobenzene-1,4-dithiol dihydrochloride REF: 54-OR74090CAS: 75464-52-7	98%	32.00 €~1,727.00 €	Mon 05 May 25
2,5-Diamino-1,4-benzenedithiol dihydrochloride REF: 10-F390425CAS: 75464-52-7	97.0%	To inquire	Wed 14 May 25
2,5-diamino-1,4-benzenedithiol REF: 3D-FD41558CAS: 75464-52-7	Min. 95%	143.00 €~447.00 €	Tue 17 Jun 25