CAS 75464-52-7
:2,5-Diamino-1,4-benzenedithiol dihydrochloride
Description:
2,5-Diamino-1,4-benzenedithiol dihydrochloride is an organic compound characterized by the presence of two amino groups and two thiol groups attached to a benzene ring. This compound is typically encountered as a dihydrochloride salt, which enhances its solubility in water. The presence of amino groups makes it a potential candidate for various applications in organic synthesis, particularly in the formation of complex molecules and as a building block in pharmaceuticals. The thiol groups contribute to its reactivity, allowing it to participate in redox reactions and form disulfide bonds, which are significant in biochemistry and materials science. Additionally, the compound may exhibit properties such as chelation with metal ions, making it useful in coordination chemistry. Safety considerations should be taken into account, as thiols can be malodorous and may pose health risks upon exposure. Overall, 2,5-Diamino-1,4-benzenedithiol dihydrochloride is a versatile compound with potential applications in various fields, including medicinal chemistry and materials development.
Formula:C6H10Cl2N2S2
InChI:InChI=1/C6H8N2S2.2ClH/c7-3-1-5(9)4(8)2-6(3)10;;/h1-2,9-10H,7-8H2;2*1H
SMILES:c1c(c(cc(c1S)N)S)N.Cl.Cl
Synonyms:- 2,5-Diaminobenzene-1,4-Dithiol Dihydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,5-Diamino-1,4-benzenedithiol Dihydrochloride
CAS:Formula:C6H8N2S2·2HClPurity:>97.0%(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:245.182,5-Diaminobenzene-1,4-dithiol dihydrochloride
CAS:2,5-Diaminobenzene-1,4-dithiol dihydrochlorideFormula:C6H10Cl2N2S2Purity:98%Color and Shape:SolidMolecular weight:245.22,5-Diamino-1,4-benzenedithiol diHCl
CAS:Formula:C6H10Cl2N2S2Purity:95%Color and Shape:SolidMolecular weight:245.19302,5-Diamino-1,4-benzenedithiol dihydrochloride
CAS:Formula:C6H10Cl2N2S2Purity:97%Color and Shape:SolidMolecular weight:245.182,5-diamino-1,4-benzenedithiol
CAS:2,5-Diamino-1,4-benzenedithiol is an organic compound that has a protonated amino group in the para position. It can be synthesized from biphenyl and dithiocarboxylic acid. The viscosity of 2,5-diamino-1,4-benzenedithiol is high and it reacts with copper chloride to form a complex. This complex is used as a diagnostic agent for cervical cancer by measuring the concentration of hydrogen ions in cervical cells. 2,5-Diamino-1,4-benzenedithiol has also been used to measure intramolecular hydrogen bonds in diacids and polymers. The detection sensitivity of this compound is high and it can be measured using magnetic resonance spectroscopy by using phosphorus pentoxide as a solvent.Formula:C6H8N2S2·2CIHPurity:Min. 95%Molecular weight:452.12 g/mol




