CymitQuimica logo

CAS 755-37-3

:

bis(2,2,3,3,4,4,5,5-octafluoropentyl) sulfate

Description:
Bis(2,2,3,3,4,4,5,5-octafluoropentyl) sulfate, with the CAS number 755-37-3, is a synthetic chemical compound characterized by its unique structure that includes two octafluoropentyl groups attached to a sulfate moiety. This compound is notable for its high fluorine content, which imparts significant hydrophobic and lipophobic properties, making it useful in various applications, including surfactants and emulsifiers. The presence of multiple fluorinated carbon chains enhances its thermal stability and chemical resistance, making it suitable for use in harsh environments. Additionally, the sulfate functional group contributes to its reactivity and potential applications in organic synthesis. Due to its fluorinated nature, this compound may exhibit low surface tension and high surface activity, which can be advantageous in formulations requiring enhanced wetting or spreading characteristics. However, the environmental impact and regulatory considerations associated with fluorinated compounds should be taken into account when evaluating its use in industrial applications.
Formula:C10H6F16O4S
InChI:InChI=1/C10H6F16O4S/c11-3(12)7(19,20)9(23,24)5(15,16)1-29-31(27,28)30-2-6(17,18)10(25,26)8(21,22)4(13)14/h3-4H,1-2H2
SMILES:C(C(C(C(C(F)F)(F)F)(F)F)(F)F)OS(=O)(=O)OCC(C(C(C(F)F)(F)F)(F)F)(F)F
Found 1 products.