CymitQuimica logo

CAS 755-53-3

:

Tris(1H,1H-heptafluorobutyl)borate

Description:
Tris(1H,1H-heptafluorobutyl)borate, with the CAS number 755-53-3, is a chemical compound characterized by its unique structure, which includes a boron atom bonded to three heptafluorobutyl groups. This compound is notable for its high fluorine content, which imparts significant thermal stability and chemical inertness, making it useful in various applications, including as a reagent in organic synthesis and as a potential additive in materials science. The presence of fluorinated alkyl groups enhances its hydrophobic properties and lowers its surface energy, which can be advantageous in coatings and surface treatments. Additionally, Tris(1H,1H-heptafluorobutyl)borate exhibits low volatility and high solubility in organic solvents, contributing to its utility in various chemical processes. Safety considerations should be taken into account due to the potential environmental and health impacts associated with fluorinated compounds. Overall, this compound represents a versatile and valuable material in advanced chemical applications.
Formula:C12H6BF21O3
InChI:InChI=1S/C12H6BF21O3/c14-4(15,7(20,21)10(26,27)28)1-35-13(36-2-5(16,17)8(22,23)11(29,30)31)37-3-6(18,19)9(24,25)12(32,33)34/h1-3H2
InChI key:XJNAPTARYFQVEU-UHFFFAOYSA-N
SMILES:B(OCC(C(C(F)(F)F)(F)F)(F)F)(OCC(C(C(F)(F)F)(F)F)(F)F)OCC(C(C(F)(F)F)(F)F)(F)F
Synonyms:
  • 1-Butanol, 2,2,3,3,4,4,4-heptafluoro-, 1,1',1''-triester with boric acid (H3BO3)
  • Tris(1H,1H-heptafluorobutyl)borate
Found 2 products.