CymitQuimica logo

CAS 755031-80-2

:

Benzenamine, 5-chloro-2-iodo-4-methyl-

Description:
Benzenamine, 5-chloro-2-iodo-4-methyl- is an organic compound characterized by its aromatic amine structure, which includes a benzene ring substituted with various functional groups. The presence of a chlorine atom at the 5-position and an iodine atom at the 2-position, along with a methyl group at the 4-position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic aromatic structure. The presence of halogen substituents can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Safety considerations should be taken into account, as halogenated compounds can pose environmental and health risks. Overall, benzenamine, 5-chloro-2-iodo-4-methyl- is a versatile compound with applications in organic synthesis and potentially in medicinal chemistry.
Formula:C7H7ClIN
InChI:InChI=1S/C7H7ClIN/c1-4-2-6(9)7(10)3-5(4)8/h2-3H,10H2,1H3
InChI key:WTQMSECCZZCDHE-UHFFFAOYSA-N
SMILES:CC1=CC(=C(C=C1Cl)N)I
Synonyms:
  • 5-Chloro-2-Iodo-4-Methylaniline
Found 3 products.