CAS 755038-65-4
:Volasertib
Description:
Volasertib, with the CAS number 755038-65-4, is a small molecule inhibitor primarily targeting the polo-like kinase 1 (PLK1), an essential protein involved in cell cycle regulation and mitosis. This compound is characterized by its role as an antineoplastic agent, making it a subject of interest in cancer research and therapy. Volasertib exhibits a high degree of specificity for PLK1, leading to the disruption of mitotic processes in cancer cells, which can result in cell cycle arrest and apoptosis. Its chemical structure includes a complex arrangement of aromatic and heterocyclic rings, contributing to its biological activity. The substance is typically administered in a clinical setting, often in combination with other chemotherapeutic agents, to enhance therapeutic efficacy against various malignancies. Additionally, ongoing studies are evaluating its pharmacokinetics, safety profile, and potential resistance mechanisms in cancer treatment. Overall, Volasertib represents a promising avenue in targeted cancer therapy, particularly for tumors with high PLK1 expression.
Formula:C34H50N8O3
InChI:InChI=1S/C34H50N8O3/c1-6-28-33(44)39(4)29-20-35-34(38-31(29)42(28)22(2)3)37-27-14-9-24(19-30(27)45-5)32(43)36-25-10-12-26(13-11-25)41-17-15-40(16-18-41)21-23-7-8-23/h9,14,19-20,22-23,25-26,28H,6-8,10-13,15-18,21H2,1-5H3,(H,36,43)(H,35,37,38)/t25-,26-,28-/m1/s1
InChI key:InChIKey=SXNJFOWDRLKDSF-STROYTFGSA-N
SMILES:C(C)(C)N1C=2C(N(C)C(=O)[C@H]1CC)=CN=C(NC3=C(OC)C=C(C(N[C@@H]4CC[C@H](CC4)N5CCN(CC6CC6)CC5)=O)C=C3)N2
Synonyms:- N-[trans-4-[4-(Cyclopropylmethyl)-1-piperazinyl]cyclohexyl]-4-[[(7R)-7-ethyl-5,6,7,8-tetrahydro-5-methyl-8-(1-methylethyl)-6-oxo-2-pteridinyl]amino]-3-methoxybenzamide
- Benzamide, N-[trans-4-[4-(cyclopropylmethyl)-1-piperazinyl]cyclohexyl]-4-[[(7R)-7-ethyl-5,6,7,8-tetrahydro-5-methyl-8-(1-methylethyl)-6-oxo-2-pteridinyl]amino]-3-methoxy-
- Volasertib
- BI 6727
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Volasertib
CAS:Volasertib (BI 6727) (BI-6727) is a potent inhibitor of PLK1 (IC50: 0.87 nM), inducing mitotic arrest and apoptosis.Formula:C34H50N8O3Purity:98% - 99.72%Color and Shape:SolidMolecular weight:618.81Ref: TM-T6019
1mg37.00€2mg50.00€5mg80.00€10mg114.00€25mg205.00€50mg334.00€100mg557.00€1mL*10mM (DMSO)96.00€Volasertib
CAS:Volasertib is an investigational small-molecule compound, which is a synthetic derivative with inhibitory activity against Polo-like kinase 1 (PLK1). PLK1 is a serine/threonine-protein kinase that plays a pivotal role in the regulation of cell cycle progression, specifically during mitosis. By inhibiting PLK1, Volasertib disrupts mitotic spindle assembly, leading to cell cycle arrest at the G2/M phase and ultimately inducing apoptosis in cancer cells.Formula:C34H50N8O3Purity:Min. 95%Molecular weight:618.81 g/molVolasertib
CAS:Controlled ProductApplications Volasertib (BI 6727) is a highly potent Polo-like kinase (PLK) inhibitor.
References Rudolph, D., et al.: Clin. Cancer Res., 15, 3094 (2009); Grinshtein, N., et al.: 71, 1385 (2011)Formula:C34H50N8O3Color and Shape:NeatMolecular weight:618.81




