CymitQuimica logo

CAS 75504-01-7

:

Pyridine, 2-(1-bromoethyl)-

Description:
Pyridine, 2-(1-bromoethyl)-, also known by its CAS number 75504-01-7, is an organic compound that features a pyridine ring substituted with a bromoethyl group at the 2-position. This compound is characterized by its aromatic nature due to the presence of the pyridine ring, which consists of a six-membered ring containing five carbon atoms and one nitrogen atom. The bromoethyl substituent introduces a halogen, which can influence the compound's reactivity and polarity. Pyridine derivatives are often used in various chemical syntheses and can serve as intermediates in the production of pharmaceuticals, agrochemicals, and other organic compounds. The presence of the bromine atom can enhance electrophilic reactivity, making it useful in nucleophilic substitution reactions. Additionally, the compound may exhibit specific physical properties such as solubility in polar solvents, and its behavior in chemical reactions can be influenced by the electron-withdrawing nature of the bromine atom. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds.
Formula:C7H8BrN
InChI:InChI=1S/C7H8BrN/c1-6(8)7-4-2-3-5-9-7/h2-6H,1H3
InChI key:NXZNOPMZKPTBHC-UHFFFAOYSA-N
SMILES:CC(C1=CC=CC=N1)Br
Found 4 products.