CAS 7554-28-1
:Diethyl D-malate
Description:
Diethyl D-malate, with the CAS number 7554-28-1, is an organic compound that belongs to the class of malates, which are esters derived from malic acid. It is characterized by its diethyl ester functional groups, which contribute to its solubility in organic solvents. The compound typically appears as a colorless to pale yellow liquid and has a fruity odor, indicative of its ester nature. Diethyl D-malate is known for its role in various chemical reactions and can serve as a chiral building block in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Its stereochemistry, being a D-enantiomer, plays a crucial role in its reactivity and interactions in biological systems. Additionally, it is relatively stable under standard conditions but may undergo hydrolysis in the presence of water, leading to the formation of D-malic acid and ethanol. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H14O5
InChI:InChI=1S/C8H14O5/c1-3-12-7(10)5-6(9)8(11)13-4-2/h6,9H,3-5H2,1-2H3/t6-/m1/s1
InChI key:InChIKey=VKNUORWMCINMRB-ZCFIWIBFSA-N
SMILES:C([C@H](C(OCC)=O)O)C(OCC)=O
Synonyms:- (2R)-2-Hydroxybutanedioic acid diethyl ester
- 1,4-Diethyl (2R)-2-hydroxybutanedioate
- Butanedioic acid, 2-hydroxy-, 1,4-diethyl ester, (2R)-
- Butanedioic acid, hydroxy-, diethyl ester, (2R)-
- Butanedioic acid, hydroxy-, diethyl ester, (R)-
- D-(+)-Malic acid diethyl ester
- Diethyl (2R)-malate
- Diethyl (R)-2-hydroxysuccinate
- Diethyl (R)-malate
- Diethyl <span class="text-smallcaps">D</span>-malate
- Malic acid, diethyl ester, <span class="text-smallcaps">D</span>-(+)-
- diethyl (2R)-2-hydroxybutanedioate
- Malic acid, diethyl ester, D-(+)-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
D-(+)-Malic acid diethyl ester
CAS:Formula:C8H14O5Purity:95%Color and Shape:LiquidMolecular weight:190.1938(R)-Diethyl 2-hydroxysuccinate
CAS:(R)-Diethyl 2-hydroxysuccinateFormula:C8H14O5Purity:98%Molecular weight:190.2Diethyl D-(+)-Malate
CAS:Formula:C8H14O5Purity:>98.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:190.20Diethyl D-Malate
CAS:Controlled ProductApplications Diethyl D-Malate (cas# 7554-28-1) is a compound useful in organic synthesis.
Formula:C8H14O5Color and Shape:NeatMolecular weight:190.194(R)-Diethyl 2-hydroxysuccinate
CAS:Formula:C8H14O5Purity:95%Color and Shape:LiquidMolecular weight:190.195




