CymitQuimica logo

CAS 755753-89-0

:

2H-Pyrazolo[3,4-b]pyridine,4,6-bis(4-fluorophenyl)-2-methyl-5-(4-pyridinyl)-

Description:
2H-Pyrazolo[3,4-b]pyridine, 4,6-bis(4-fluorophenyl)-2-methyl-5-(4-pyridinyl)- is a complex organic compound characterized by its pyrazolo-pyridine core structure, which features a fused bicyclic system. This compound contains multiple functional groups, including fluorophenyl and pyridinyl substituents, which contribute to its chemical reactivity and potential biological activity. The presence of fluorine atoms typically enhances lipophilicity and can influence the compound's pharmacokinetic properties. The methyl group at the 2-position of the pyrazolo ring may affect steric hindrance and electronic properties, while the pyridinyl group can participate in hydrogen bonding and coordination interactions. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as derivatives of pyrazolo-pyridine structures have been explored for various therapeutic effects. Its specific properties, such as solubility, melting point, and spectral characteristics, would depend on the molecular interactions and the environment in which it is studied.
Formula:C24H16F2N4
InChI:InChI=1S/C24H16F2N4/c1-30-14-20-21(15-2-6-18(25)7-3-15)22(16-10-12-27-13-11-16)23(28-24(20)29-30)17-4-8-19(26)9-5-17/h2-14H,1H3
InChI key:VMAKTIDYMSNPOV-UHFFFAOYSA-N
SMILES:CN1C=C2C(=C(C(=NC2=N1)C3=CC=C(C=C3)F)C4=CC=NC=C4)C5=CC=C(C=C5)F
Found 3 products.