CymitQuimica logo

CAS 75626-12-9

:

4-phenyl-1,2,3,4-tetrahydroisoquinoline hydrochloride

Description:
4-Phenyl-1,2,3,4-tetrahydroisoquinoline hydrochloride is a chemical compound that belongs to the class of tetrahydroisoquinolines, which are bicyclic organic compounds. This substance is characterized by its bicyclic structure, featuring a phenyl group attached to the tetrahydroisoquinoline core. It typically appears as a white to off-white crystalline powder and is soluble in water and various organic solvents, which makes it useful in pharmaceutical applications. The hydrochloride salt form enhances its stability and solubility, facilitating its use in biological studies and potential therapeutic applications. This compound has garnered interest in medicinal chemistry due to its structural similarity to various bioactive molecules, suggesting potential pharmacological properties. Its synthesis often involves multi-step organic reactions, and it may be utilized in research related to neuropharmacology and other fields. As with many chemical substances, handling should be conducted with care, adhering to safety protocols to mitigate any risks associated with its use.
Formula:C15H16ClN
InChI:InChI=1/C15H15N.ClH/c1-2-6-12(7-3-1)15-11-16-10-13-8-4-5-9-14(13)15;/h1-9,15-16H,10-11H2;1H
InChI key:OSZMNJRKIPAVOS-UHFFFAOYSA-N
SMILES:c1ccc(cc1)C1CNCc2ccccc12.Cl
Synonyms:
  • 4-Phenyl-1,2,3,4-tetrahydroisoquinoline hydrochloride (1:1)
Found 4 products.