CymitQuimica logo

CAS 75631-61-7

:

Ethanol, 2-(4-ethoxyphenoxy)-

Description:
Ethanol, 2-(4-ethoxyphenoxy)-, also known by its CAS number 75631-61-7, is an organic compound characterized by its structure, which features an ethoxy group attached to a phenoxy moiety. This compound typically exhibits properties associated with both alcohols and ethers, including moderate solubility in water due to the presence of the hydroxyl (-OH) group, while also being soluble in organic solvents due to its hydrophobic aromatic ring. Ethanol, 2-(4-ethoxyphenoxy)- may be utilized in various applications, including as a solvent or in the synthesis of other chemical compounds. Its molecular structure suggests potential interactions with biological systems, which may warrant investigation in pharmacological or toxicological contexts. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, this compound exemplifies the diverse functionalities that can arise from modifications to simple alcohol structures, leading to unique chemical behaviors and applications.
Formula:C10H14O3
InChI:InChI=1S/C10H14O3/c1-2-12-9-3-5-10(6-4-9)13-8-7-11/h3-6,11H,2,7-8H2,1H3
InChI key:OKNKODGWSKWZIY-UHFFFAOYSA-N
SMILES:CCOC1=CC=C(C=C1)OCCO
Found 3 products.