CymitQuimica logo

CAS 75636-88-3

:

1,4-Benzenedicarbonitrile,2,5-diamino-

Description:
1,4-Benzenedicarbonitrile, 2,5-diamino- is an organic compound characterized by the presence of two amino groups and two cyano groups attached to a benzene ring. Its molecular structure features a benzene core with cyano groups (-C≡N) at the 1 and 4 positions and amino groups (-NH2) at the 2 and 5 positions. This compound is typically a solid at room temperature and may exhibit properties such as solubility in polar solvents due to the presence of the amino groups, which can engage in hydrogen bonding. The cyano groups contribute to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and polymerization processes. Additionally, the compound may have applications in materials science, particularly in the synthesis of polymers or as intermediates in organic synthesis. Safety data should be consulted for handling and storage, as compounds with cyano groups can be toxic and require appropriate precautions.
Formula:C8H6N4
InChI:InChI=1S/C8H6N4/c9-3-5-1-7(11)6(4-10)2-8(5)12/h1-2H,11-12H2
InChI key:DJVJDQRJKTVAEU-UHFFFAOYSA-N
SMILES:C1=C(C(=CC(=C1N)C#N)N)C#N
Synonyms:
  • 1,4-Diamino-2,5-dicyanobenzene
Found 4 products.