CAS 75659-49-3
:1-ethyl-2-ethynylbenzene
Description:
1-Ethyl-2-ethynylbenzene, also known by its CAS number 75659-49-3, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both an ethyl group and an ethynyl group. This compound typically exhibits a colorless to pale yellow liquid form and has a distinct aromatic odor. It is insoluble in water but soluble in organic solvents, reflecting its hydrophobic nature. The presence of the ethynyl group introduces a triple bond, contributing to its reactivity and potential for undergoing various chemical reactions, such as polymerization or addition reactions. The compound's boiling point and melting point are influenced by its molecular structure and substituents, which also affect its physical properties. 1-Ethyl-2-ethynylbenzene is utilized in organic synthesis and may serve as an intermediate in the production of more complex chemical entities. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C10H10
InChI:InChI=1/C10H10/c1-3-9-7-5-6-8-10(9)4-2/h1,5-8H,4H2,2H3
SMILES:C#Cc1ccccc1CC
Synonyms:- Benzene, 1-ethyl-2-ethynyl-
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1-Ethyl-2-ethynylbenzene, 95%
CAS:Formula:C10H10Purity:95%Color and Shape:Yellow oilMolecular weight:130.191-Ethyl-2-ethynylbenzene
CAS:1-Ethyl-2-ethynylbenzene is an indene that can be synthesized by the reaction of 1-ethylbenzene with ethynylmagnesium bromide and trifluoroacetyl chloride. 1-Ethyl-2-ethynylbenzene reacts as a nucleophile with electrophiles, such as phenylsulfonyl and acetylene compounds, to form sulfones and acetylenes. It can also react with tetrafluoroborates to form indenes.
Formula:C10H10Purity:Min. 95%Molecular weight:130.19 g/mol


