CAS 7567-63-7
:1,3,5-Triethynylbenzene
Description:
1,3,5-Triethynylbenzene is an organic compound characterized by its unique structure, which features a benzene ring substituted with three ethynyl groups at the 1, 3, and 5 positions. This arrangement imparts significant rigidity and planarity to the molecule, making it an interesting candidate for various applications in materials science, particularly in the development of conductive polymers and organic electronics. The presence of multiple ethynyl groups enhances its reactivity, allowing for further functionalization and polymerization. 1,3,5-Triethynylbenzene is typically a solid at room temperature and exhibits good thermal stability. Its synthesis often involves the coupling of appropriate precursors through reactions such as Sonogashira coupling. Additionally, due to its conjugated system, it may exhibit interesting optical properties, including potential fluorescence. The compound is also of interest in the field of supramolecular chemistry and nanotechnology, where it can be used to create complex architectures or as a building block for more intricate molecular structures. Safety precautions should be taken when handling this compound, as with many organic substances, due to potential toxicity and reactivity.
Formula:C12H6
InChI:InChI=1/C12H6/c1-4-10-7-11(5-2)9-12(6-3)8-10/h1-3,7-9H
SMILES:C#Cc1cc(C#C)cc(C#C)c1
Synonyms:- Benzene, 1,3,5-triethynyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,3,5-Triethynylbenzene
CAS:Formula:C12H6Purity:>98.0%(GC)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:150.181,3,5-Triethynylbenzene, 98%
CAS:1,3,5-Triethynylbenzene is used as the carbon precursor for graphene synthesis on rhodium. It is also used as a connecting unit for various transition metal building blocks. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation andFormula:C12H6Purity:98%Color and Shape:White to cream to yellow to brown or brown/black, Crystals or powder or crystalline powderMolecular weight:150.181,3,5-Triethynylbenzene
CAS:1,3,5-TriethynylbenzeneFormula:C12H6Purity:98%Color and Shape:SolidMolecular weight:150.17603Ref: IN-DA0032L4
250mg20.00€1g33.00€5g69.00€10g108.00€25g205.00€100g546.00€250g1,007.00€500g1,990.00€1kg3,928.00€1,3,5-Triethynylbenzene
CAS:Formula:C12H6Purity:95%Color and Shape:Solid, Pale yellow to greyish yellow red powderMolecular weight:150.18




