CAS 75677-02-0

3-(4-chlorophenyl)propanal

Description:

3-(4-Chlorophenyl)propanal, with the CAS number 75677-02-0, is an organic compound characterized by its aldehyde functional group and a chlorinated aromatic ring. This compound features a propanal backbone, which consists of a three-carbon chain terminating in a carbonyl group (–CHO). The presence of the 4-chlorophenyl group indicates that a chlorinated phenyl ring is attached to the third carbon of the propanal chain, contributing to its unique chemical properties. The chlorination can influence the compound's reactivity, solubility, and potential interactions with biological systems. Typically, aldehydes like this one are known for their reactivity, particularly in nucleophilic addition reactions, and can serve as intermediates in various organic synthesis processes. Additionally, the compound may exhibit distinct physical properties such as boiling and melting points, which are influenced by its molecular structure and the presence of the chlorine substituent. Overall, 3-(4-chlorophenyl)propanal is of interest in both synthetic organic chemistry and potential applications in pharmaceuticals or agrochemicals.

Formula: C₉H₉ClO

InChI: InChI=1/C9H9ClO/c10-9-5-3-8(4-6-9)2-1-7-11/h3-7H,1-2H2

SMILES: C(Cc1ccc(cc1)Cl)C=O

Synonyms:

• 3-(4-Chlorphenyl)propanal

Benzenepropanal,4-chloro-

CAS: 75677-02-0

Formula: C₉H₉ClO

Purity: 95%

Color and Shape: Solid

Molecular weight: 168.6202

Ref: IN-DA008PM1

3-(4-Chlorophenyl)propanal

CAS: 75677-02-0

3-(4-Chlorophenyl)propanal

Purity: 95%

Molecular weight: 168.62g/mol

Ref: 54-OR1046330

3-(4-Chlorophenyl)propionaldehyde

CAS: 75677-02-0

Formula: C₉H₉ClO

Purity: 95%

Color and Shape: Liquid

Molecular weight: 168.62

Ref: 10-F208268

3-(4-Chlorophenyl)propanal

CAS: 75677-02-0

3-(4-Chlorophenyl)propanal is a regioselective glycol ether that has been used as a catalyst in organic synthesis. It produces high yields of carbonyl complexes with macrocyclic compounds and homogeneous catalysts. 3-(4-Chlorophenyl)propanal also has been shown to be an effective catalyst for the formation of phosphine rhodium complexes and macrocyclic ruthenium complexes, which are used in high-rate reactions.

Formula: C₉H₉ClO

Purity: Min. 95%

Molecular weight: 168.62 g/mol

Ref: 3D-ADA67702