CymitQuimica logo

CAS 75677-02-0

:

3-(4-chlorophenyl)propanal

Description:
3-(4-Chlorophenyl)propanal, with the CAS number 75677-02-0, is an organic compound characterized by its aldehyde functional group and a chlorinated aromatic ring. This compound features a propanal backbone, which consists of a three-carbon chain terminating in a carbonyl group (–CHO). The presence of the 4-chlorophenyl group indicates that a chlorinated phenyl ring is attached to the third carbon of the propanal chain, contributing to its unique chemical properties. The chlorination can influence the compound's reactivity, solubility, and potential interactions with biological systems. Typically, aldehydes like this one are known for their reactivity, particularly in nucleophilic addition reactions, and can serve as intermediates in various organic synthesis processes. Additionally, the compound may exhibit distinct physical properties such as boiling and melting points, which are influenced by its molecular structure and the presence of the chlorine substituent. Overall, 3-(4-chlorophenyl)propanal is of interest in both synthetic organic chemistry and potential applications in pharmaceuticals or agrochemicals.
Formula:C9H9ClO
InChI:InChI=1/C9H9ClO/c10-9-5-3-8(4-6-9)2-1-7-11/h3-7H,1-2H2
InChI key:UXIFTAZOVKVCBX-UHFFFAOYSA-N
SMILES:C(Cc1ccc(cc1)Cl)C=O
Synonyms:
  • 3-(4-Chlorphenyl)propanal
Found 6 products.