CymitQuimica logo

CAS 75680-91-0

:

2-Thiazolecarboxylic acid, 4-(4-chlorophenyl)-, ethyl ester

Description:
2-Thiazolecarboxylic acid, 4-(4-chlorophenyl)-, ethyl ester, identified by CAS number 75680-91-0, is an organic compound characterized by its thiazole ring structure, which contributes to its biological activity and chemical reactivity. This compound features a carboxylic acid functional group and an ethyl ester moiety, indicating it can undergo hydrolysis to release the corresponding acid. The presence of a 4-chlorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. Typically, compounds of this nature exhibit moderate to high stability under standard conditions, but their reactivity can vary based on environmental factors such as pH and temperature. Additionally, the thiazole ring is known for its role in various pharmacological activities, making this compound of interest in medicinal chemistry. Its synthesis and applications may be explored in fields such as agrochemicals or pharmaceuticals, where derivatives of thiazole are often investigated for their potential therapeutic effects. Safety and handling precautions should be observed due to the presence of chlorine and the potential for biological activity.
Formula:C12H10ClNO2S
InChI:InChI=1S/C12H10ClNO2S/c1-2-16-12(15)11-14-10(7-17-11)8-3-5-9(13)6-4-8/h3-7H,2H2,1H3
InChI key:RCSJMEGGOPRTDG-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=NC(=CS1)C2=CC=C(C=C2)Cl
Found 3 products.