CymitQuimica logo

CAS 756849-36-2

:

3-Thiophenecarboxamide, 2-[(2-[1,1'-biphenyl]-4-ylacetyl)amino]-

Description:
3-Thiophenecarboxamide, 2-[(2-[1,1'-biphenyl]-4-ylacetyl)amino]- is a chemical compound characterized by its unique structure, which includes a thiophene ring and a biphenyl moiety. The presence of the thiophene ring contributes to its potential as a heterocyclic compound, often associated with various biological activities. The amide functional group in the structure indicates that it can participate in hydrogen bonding, which may influence its solubility and reactivity. This compound is likely to exhibit properties typical of amides, such as moderate polarity and the ability to form stable complexes with other molecules. Its biphenyl substituent may enhance its lipophilicity, potentially affecting its pharmacokinetic properties if considered for medicinal applications. Overall, the combination of these structural features suggests that this compound could have interesting applications in fields such as pharmaceuticals, materials science, or organic synthesis, although specific biological or chemical properties would require further investigation through empirical studies.
Formula:C19H16N2O2S
InChI:InChI=1S/C19H16N2O2S/c20-18(23)16-10-11-24-19(16)21-17(22)12-13-6-8-15(9-7-13)14-4-2-1-3-5-14/h1-11H,12H2,(H2,20,23)(H,21,22)
InChI key:YYXUXBGOPPLOIM-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2=CC=C(C=C2)CC(=O)NC3=C(C=CS3)C(=O)N
Synonyms:
  • 3-Thiophenecarboxamide, 2-[(2-[1,1'-biphenyl]-4-ylacetyl)amino]-
  • JNK-IN-21
  • WAY-626309
  • 2-(2-([1,1'-Biphenyl]-4-yl)acetamido)thiophene-3-carboxamide
Found 3 products.