CAS 7569-26-8
:chloromethyl P-tolyl sulfone
Description:
Chloromethyl P-tolyl sulfone, with the CAS number 7569-26-8, is an organic compound characterized by the presence of a chloromethyl group and a P-tolyl sulfone moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is known for its reactivity, particularly due to the chloromethyl group, which can participate in nucleophilic substitution reactions. The sulfone functional group contributes to its polar nature, enhancing its solubility in polar solvents. Chloromethyl P-tolyl sulfone is often utilized in organic synthesis as an intermediate for the preparation of various pharmaceuticals and agrochemicals. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety precautions are necessary when handling this compound, as it may pose health risks, including irritation to the skin and respiratory system. Proper storage and disposal methods should be followed to mitigate environmental impact and ensure safety in laboratory settings.
Formula:C8H9ClO2S
InChI:InChI=1/C8H9ClO2S/c1-7-2-4-8(5-3-7)12(10,11)6-9/h2-5H,6H2,1H3
SMILES:Cc1ccc(cc1)S(=O)(=O)CCl
Synonyms:- p-Toluenesulfonylmethyl chloride
- 1-[(Chloromethyl)Sulfonyl]-4-Methylbenzene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
p-Toluenesulfonylmethyl Chloride
CAS:Formula:C8H9ClO2SPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:204.671-((Chloromethyl)sulfonyl)-4-methylbenzene
CAS:Formula:C8H9ClO2SPurity:98%Color and Shape:SolidMolecular weight:204.67391-(Chloromethylsulfonyl)-4-methylbenzene
CAS:1-(Chloromethylsulfonyl)-4-methylbenzeneFormula:C8H9ClO2SPurity:98%Molecular weight:204.673861-((Chloromethyl)sulfonyl)-4-methylbenzene
CAS:1-((Chloromethyl)sulfonyl)-4-methylbenzeneFormula:C8H9ClO2SPurity:98%Molecular weight:204.671-((Chloromethyl)sulfonyl)-4-methylbenzene
CAS:Formula:C8H9ClO2SPurity:98%Color and Shape:SolidMolecular weight:204.67p-Toluenesulfonylmethyl Chloride
CAS:p-Toluenesulfonylmethyl Chloride is a reactive compound that can be used as an alkylating agent. It has a carbonyl group, which reacts with nucleophiles and can be used to form carbon-carbon bonds. p-Toluenesulfonylmethyl Chloride is also able to react with aldehydes and sulfoxides, forming anions and pyridazine. This chemical is used in the synthesis of organic compounds, including acetaldehyde. In addition, it can be used in magnetic resonance spectroscopy (MRS) experiments to identify the structure of aldehydes.Formula:C8H9ClO2SPurity:Min. 95%Molecular weight:204.67 g/mol





