CymitQuimica logo

CAS 757192-65-7

:

1,8-Dimethyl-1,3-diazaspiro[4.5]decane-2,4-dione

Description:
1,8-Dimethyl-1,3-diazaspiro[4.5]decane-2,4-dione, with the CAS number 757192-65-7, is a chemical compound characterized by its unique spirocyclic structure, which includes two nitrogen atoms in a diaza configuration. This compound features a bicyclic framework that contributes to its potential biological activity and chemical reactivity. The presence of two carbonyl groups (diones) in the structure suggests that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The dimethyl substituents enhance its lipophilicity, potentially influencing its solubility and interaction with biological membranes. Additionally, the spiro structure can impart rigidity, which may affect the compound's conformational properties and interactions with biological targets. While specific applications or biological activities may vary, compounds of this type are often explored in medicinal chemistry for their potential therapeutic effects. Overall, 1,8-Dimethyl-1,3-diazaspiro[4.5]decane-2,4-dione represents a class of compounds with intriguing structural features and potential utility in various chemical and pharmaceutical contexts.
Formula:C10H16N2O2
InChI:InChI=1S/C10H16N2O2/c1-7-3-5-10(6-4-7)8(13)11-9(14)12(10)2/h7H,3-6H2,1-2H3,(H,11,13,14)
InChI key:InChIKey=KZXCFFUWVIAYNJ-UHFFFAOYSA-N
SMILES:CN1C2(C(=O)NC1=O)CCC(C)CC2
Synonyms:
  • 1,3-Diazaspiro[4.5]decane-2,4-dione, 1,8-dimethyl-
  • 1,8-Dimethyl-1,3-diazaspiro[4.5]decane-2,4-dione
Found 2 products.