CymitQuimica logo

CAS 757192-67-9

:

2-Chloro-N-(2-cyanoethyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide

Description:
2-Chloro-N-(2-cyanoethyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide, with CAS number 757192-67-9, is a synthetic organic compound characterized by its complex molecular structure, which includes a chloro group, a cyanoethyl moiety, and a benzodioxin ring system. This compound typically exhibits properties associated with both polar and nonpolar characteristics due to the presence of various functional groups. It is likely to be soluble in organic solvents while having limited solubility in water. The presence of the chloro group suggests potential reactivity, particularly in nucleophilic substitution reactions. The cyanoethyl group may impart additional reactivity and influence the compound's biological activity. The benzodioxin structure can contribute to the compound's stability and may also affect its interaction with biological targets. Overall, this compound may be of interest in medicinal chemistry and pharmacology, particularly for its potential applications in drug development or as a biochemical probe, although specific biological activities would require further investigation.
Formula:C13H13ClN2O3
InChI:InChI=1S/C13H13ClN2O3/c14-9-13(17)16(5-1-4-15)10-2-3-11-12(8-10)19-7-6-18-11/h2-3,8H,1,5-7,9H2
InChI key:InChIKey=GLDJSVHDOXCYPT-UHFFFAOYSA-N
SMILES:N(CCC#N)(C(CCl)=O)C=1C=C2C(=CC1)OCCO2
Synonyms:
  • 2-Chloro-N-(2-cyanoethyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)acetamide
  • Acetamide, 2-chloro-N-(2-cyanoethyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-
Found 5 products.