CymitQuimica logo

CAS 757192-84-0

:

2-[[2-[(2,3-Dihydro-1,5-dimethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)amino]-1-methyl-2-oxoethyl]thio]acetic acid

Description:
The chemical substance known as 2-[[2-[(2,3-Dihydro-1,5-dimethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)amino]-1-methyl-2-oxoethyl]thio]acetic acid, with the CAS number 757192-84-0, is a complex organic compound characterized by its multi-functional structure. It features a pyrazole ring, which is a five-membered heterocyclic compound containing two nitrogen atoms, contributing to its biological activity. The presence of a thioether linkage and an acetic acid moiety suggests potential reactivity and solubility in polar solvents. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry. Its structural components indicate potential interactions with biological targets, possibly influencing enzyme activity or receptor binding. The presence of multiple functional groups, including amine and carbonyl groups, enhances its potential for diverse chemical reactivity. Overall, this compound's unique structure and functional groups may contribute to its utility in research and therapeutic applications, although specific biological activities would require further investigation.
Formula:C16H19N3O4S
InChI:InChI=1S/C16H19N3O4S/c1-10-14(17-15(22)11(2)24-9-13(20)21)16(23)19(18(10)3)12-7-5-4-6-8-12/h4-8,11H,9H2,1-3H3,(H,17,22)(H,20,21)
InChI key:InChIKey=ZEKLCZAVTAXCOJ-UHFFFAOYSA-N
SMILES:O=C1N(N(C)C(C)=C1NC(C(SCC(O)=O)C)=O)C2=CC=CC=C2
Synonyms:
  • 2-[[2-[(2,3-Dihydro-1,5-dimethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)amino]-1-methyl-2-oxoethyl]thio]acetic acid
  • Acetic acid, 2-[[2-[(2,3-dihydro-1,5-dimethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)amino]-1-methyl-2-oxoethyl]thio]-
  • Acetic acid, [[2-[(2,3-dihydro-1,5-dimethyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)amino]-1-methyl-2-oxoethyl]thio]-
Found 1 products.