CymitQuimica logo

CAS 75735-44-3

:

2-Thiophenecarboxylic acid, 3-nitro-, methyl ester

Description:
2-Thiophenecarboxylic acid, 3-nitro-, methyl ester, identified by CAS number 75735-44-3, is an organic compound characterized by the presence of a thiophene ring, a carboxylic acid functional group, and a nitro substituent. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and acetone, while being less soluble in water due to its hydrophobic thiophene structure. The methyl ester group contributes to its reactivity, making it a potential candidate for various chemical reactions, including esterification and nucleophilic substitution. The nitro group introduces significant electron-withdrawing characteristics, influencing the compound's reactivity and stability. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on environmental conditions and the presence of other chemical species. Overall, 2-thiophenecarboxylic acid, 3-nitro-, methyl ester is a versatile compound with applications in synthetic organic chemistry.
Formula:C6H5NO4S
InChI:InChI=1S/C6H5NO4S/c1-11-6(8)5-4(7(9)10)2-3-12-5/h2-3H,1H3
InChI key:DDLFZCCIZTVFBQ-UHFFFAOYSA-N
SMILES:COC(=O)C1=C(C=CS1)[N+](=O)[O-]
Found 1 products.