CymitQuimica logo

CAS 7578-45-2

:

Butanamide, 4-chloro-N-phenyl-

Description:
Butanamide, 4-chloro-N-phenyl- is an organic compound characterized by its amide functional group, which consists of a carbonyl (C=O) linked to a nitrogen atom (N). The presence of a phenyl group (a benzene ring) attached to the nitrogen atom contributes to its aromatic properties, while the 4-chloro substituent on the butanamide backbone indicates that a chlorine atom is attached to the fourth carbon of the butane chain. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its chemical structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis. The presence of both the amide and chloro functional groups may influence its reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions or coupling reactions. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, Butanamide, 4-chloro-N-phenyl- is a compound of interest in both industrial and research settings.
Formula:C10H12ClNO
InChI:InChI=1S/C10H12ClNO/c11-8-4-7-10(13)12-9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,12,13)
InChI key:GJMGKNWSRKDALN-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)NC(=O)CCCCl
Found 2 products.