CymitQuimica logo

CAS 758-21-4

:

Ethyldimethylsilane

Description:
Ethyldimethylsilane, with the CAS number 758-21-4, is an organosilicon compound characterized by its silane structure, which includes a silicon atom bonded to ethyl and two methyl groups. This compound is typically a colorless liquid at room temperature and exhibits a low viscosity. Ethyldimethylsilane is known for its hydrophobic properties, making it useful in various applications, including as a precursor in the synthesis of silicone polymers and as a surface modifier. Its chemical stability and resistance to moisture contribute to its utility in coatings and sealants. Additionally, it can participate in reactions typical of silanes, such as hydrolysis and condensation, leading to the formation of siloxane networks. Ethyldimethylsilane is also of interest in the field of organometallic chemistry and can be utilized in the preparation of other silicon-containing compounds. Safety precautions should be observed when handling this substance, as it may pose health risks if inhaled or ingested.
Formula:C4H12Si
InChI:InChI=1S/C4H12Si/c1-4-5(2)3/h5H,4H2,1-3H3
InChI key:InChIKey=QGBMSFLTRRZTGI-UHFFFAOYSA-N
SMILES:[SiH](CC)(C)C
Synonyms:
  • Dimethylethylsilane
  • Ethyl(Dimethyl)Silyl
  • Silane, ethyldimethyl-
  • Ethyldimethylsilane
Found 6 products.