CAS 75804-28-3
:2,3-dimethylbutane-2,3-diamine dihydrochloride
Description:
2,3-Dimethylbutane-2,3-diamine dihydrochloride is an organic compound characterized by its structure, which includes two amine groups attached to a branched alkane backbone. This compound is a derivative of 2,3-dimethylbutane, featuring two amino groups at the 2 and 3 positions, which contribute to its basicity and reactivity. The dihydrochloride form indicates that the amine groups are protonated, enhancing its solubility in water and making it suitable for various applications, particularly in biological and pharmaceutical contexts. The presence of the dihydrochloride salt form also suggests that it may be used in formulations where stability and ease of handling are important. As a diamine, it can participate in various chemical reactions, including those involving nucleophilic substitution and polymerization. Its properties, such as melting point, boiling point, and specific reactivity, would depend on the conditions and the presence of other substances in the environment. Overall, 2,3-dimethylbutane-2,3-diamine dihydrochloride is a versatile compound with potential applications in organic synthesis and medicinal chemistry.
Formula:C6H18Cl2N2
InChI:InChI=1/C6H16N2.2ClH/c1-5(2,7)6(3,4)8;;/h7-8H2,1-4H3;2*1H
SMILES:CC(C)(C(C)(C)N)N.Cl.Cl
Synonyms:- 2,3-Butanediamine, 2,3-Dimethyl-, Hydrochloride (1:2)
- 2,3-Dimethylbutane-2,3-diamine dihydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
2,3-Dimethyl-2,3-butanediamine Dihydrochloride
CAS:Formula:C6H16N2·2HClPurity:>98.0%(T)(N)Color and Shape:White to Almost white powder to crystalMolecular weight:189.122,3-Dimethyl-2,3-butanediamine Dihydrochloride (2,3-dimethylbutane-2,3-diamine, hydrochloride)
CAS:Other acyclic polyamines and their derivatives; salts thereofFormula:C6H16N2·2HClColor and Shape:White Off-White SolidMolecular weight:116.131352,3-Dimethyl-2,3-butanediamine Dihydrochloride
CAS:2,3-Dimethyl-2,3-butanediamine DihydrochlorideFormula:C6H18Cl2N2Purity:95%Molecular weight:189.132,3-Dimethyl-2,3-butanediamine diHCl
CAS:Formula:C6H18Cl2N2Purity:95%Color and Shape:SolidMolecular weight:189.12652,3-Dimethyl-2,3-Butanediamine Dihydrochloride
CAS:2,3-Dimethyl-2,3-Butanediamine DihydrochloridePurity:98%Molecular weight:189.13g/molClavulanic Acid Impurity 7 DiHCl
CAS:Formula:C6H16N2·2HClColor and Shape:White To Off-White SolidMolecular weight:116.21 2*36.462,3-Dimethyl-2,3-butanediamine dihydrochloride
CAS:Formula:C6H18Cl2N2Purity:98.0%Color and Shape:Solid, PowderMolecular weight:189.122,3-Dimethyl-2,3-butanediamine dihydrochloride
CAS:Versatile small molecule scaffoldFormula:C6H16N2·2HClPurity:Min. 95%Molecular weight:189.13 g/mol2,3-Dimethylbutane-2,3-diamine Dihydrochloride
CAS:Formula:C6H162N2(HCl)Molecular weight:116.21 : 2(36.46)








