CymitQuimica logo

CAS 75860-79-6

:

5-methylthieno[2,3-d]pyrimidine-2,4(1H,3H)-dione

Description:
5-Methylthieno[2,3-d]pyrimidine-2,4(1H,3H)-dione, with the CAS number 75860-79-6, is a heterocyclic compound characterized by a fused thieno and pyrimidine ring system. This compound features a methyl group at the 5-position of the thieno ring and two carbonyl groups at the 2 and 4 positions of the pyrimidine ring, contributing to its diketone structure. The presence of these functional groups imparts significant chemical reactivity, making it a potential candidate for various synthetic applications in medicinal chemistry and drug development. The compound is typically solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its unique structure allows for potential interactions with biological targets, which can be explored for therapeutic purposes. Additionally, the thieno and pyrimidine moieties are known for their roles in various biological activities, including antimicrobial and anticancer properties. Overall, 5-methylthieno[2,3-d]pyrimidine-2,4(1H,3H)-dione represents an interesting compound for further research in organic and medicinal chemistry.
Formula:C7H6N2O2S
InChI:InChI=1/C7H6N2O2S/c1-3-2-12-6-4(3)5(10)8-7(11)9-6/h2H,1H3,(H2,8,9,10,11)
InChI key:GKMPAIVLIOXQSS-UHFFFAOYSA-N
SMILES:Cc1csc2c1c(nc(n2)O)O
Found 2 products.