CymitQuimica logo

CAS 75867-39-9

:

4-[(trimethylsilyl)ethynyl]aniline

Description:
4-[(Trimethylsilyl)ethynyl]aniline, with the CAS number 75867-39-9, is an organic compound characterized by the presence of an aniline group substituted with a trimethylsilyl-ethynyl moiety. This compound features a phenyl ring attached to an amino group (aniline), which is further substituted at the para position with a trimethylsilyl group linked to an ethynyl group. The trimethylsilyl group enhances the compound's stability and solubility in organic solvents, making it useful in various synthetic applications. The ethynyl group introduces a triple bond, which can participate in further chemical reactions, such as cross-coupling reactions or polymerization processes. This compound is typically used in organic synthesis, particularly in the development of advanced materials and pharmaceuticals. Its unique structure allows for potential applications in electronic materials and as a building block in the synthesis of more complex organic molecules. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C11H15NSi
InChI:InChI=1/C11H15NSi/c1-13(2,3)9-8-10-4-6-11(12)7-5-10/h4-7H,12H2,1-3H3
InChI key:CHTZIDLXGXGNMA-UHFFFAOYSA-N
SMILES:C[Si](C)(C)C#Cc1ccc(cc1)N
Found 5 products.