CymitQuimica logo

CAS 758709-44-3

:

1-(1,3-Dimethyl-1H-pyrazol-4-yl)-4,4,4-trifluoro-1,3-butanedione

Description:
1-(1,3-Dimethyl-1H-pyrazol-4-yl)-4,4,4-trifluoro-1,3-butanedione, with CAS number 758709-44-3, is a chemical compound characterized by its unique structure that includes a pyrazole ring and a trifluorinated diketone moiety. This compound typically exhibits properties such as high stability due to the presence of the trifluoromethyl groups, which can enhance lipophilicity and influence its reactivity. The pyrazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The trifluorinated diketone structure may also impart specific electronic properties, affecting its interactions in various chemical environments. Additionally, this compound may be utilized in synthetic organic chemistry as a building block or intermediate in the development of pharmaceuticals or agrochemicals. Its solubility and reactivity can vary depending on the solvent and conditions, making it important to consider these factors in practical applications. Overall, this compound represents a versatile structure with potential applications in various fields of chemistry.
Formula:C9H9F3N2O2
InChI:InChI=1S/C9H9F3N2O2/c1-5-6(4-14(2)13-5)7(15)3-8(16)9(10,11)12/h4H,3H2,1-2H3
InChI key:InChIKey=YOUQVUDXGZRPNP-UHFFFAOYSA-N
SMILES:C(CC(C(F)(F)F)=O)(=O)C1=CN(C)N=C1C
Synonyms:
  • 1-(1,3-Dimethylpyrazol-4-yl)-4,4,4-trifluorobutane-1,3-dione
  • 1-(1,3-Dimethyl-1H-pyrazol-4-yl)-4,4,4-trifluoro-1,3-butanedione
  • 1,3-Butanedione, 1-(1,3-dimethyl-1H-pyrazol-4-yl)-4,4,4-trifluoro-
Found 1 products.