CymitQuimica logo

CAS 7589-43-7

:

(1R,2R)-1-(heptafluoropropyl)-2-iodocyclohexane

Description:
(1R,2R)-1-(heptafluoropropyl)-2-iodocyclohexane is a halogenated organic compound characterized by the presence of both iodine and a heptafluoropropyl group attached to a cyclohexane ring. The compound features a chiral center, which contributes to its stereochemistry, specifically the (1R,2R) configuration. This configuration can influence its physical and chemical properties, such as solubility, reactivity, and interaction with biological systems. The heptafluoropropyl group introduces significant fluorine content, which can enhance the compound's lipophilicity and stability against oxidation. Additionally, the presence of iodine may impart unique reactivity, particularly in nucleophilic substitution reactions. The compound is likely to be non-polar due to the fluorinated alkyl chain, affecting its solubility in various solvents. Its applications may span fields such as materials science, pharmaceuticals, or as a reagent in organic synthesis, although specific uses would depend on further research and development. Safety data should be consulted due to the presence of halogens, which can pose health and environmental risks.
Formula:C9H10F7I
InChI:InChI=1/C9H10F7I/c10-7(11,8(12,13)9(14,15)16)5-3-1-2-4-6(5)17/h5-6H,1-4H2/t5-,6+/m0/s1
InChI key:OPDPCHBOZHWKOZ-NTSWFWBYSA-N
SMILES:C1CC[C@H]([C@H](C1)C(C(C(F)(F)F)(F)F)(F)F)I
Synonyms:
  • cyclohexane, 1-(1,1,2,2,3,3,3-heptafluoropropyl)-2-iodo-, (1R,2R)-
  • (1R,2R)-1-(Heptafluoropropyl)-2-iodocyclohexane
Found 2 products.